C9H14N2O — CID 130791941
3-(2-cyclopropylethyl)-4-methyl-1,2-oxazol-5-amine (PubChem CID 130791941) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is 3-(2-cyclopropylethyl)-4-methyl-1,2-oxazol-5-amine.
| Compound Name | 3-(2-cyclopropylethyl)-4-methyl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 130791941 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 3-(2-cyclopropylethyl)-4-methyl-1,2-oxazol-5-amine |
| SMILES | Cc1c(CCC2CC2)noc1N |
| InChI | InChI=1S/C9H14N2O/c1-6-8(11-12-9(6)10)5-4-7-2-3-7/h7H,2-5,10H2,1H3 |
| InChIKey | AKFWQOOEDWZDNQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |