C15H19N3O2 — CID 80525003
3-[2-(oxan-2-yl)ethyl]-4-pyridin-4-yl-1,2-oxazol-5-amine (PubChem CID 80525003) has the molecular formula C15H19N3O2 and a molecular weight of 273.34 g/mol. Its IUPAC name is 3-[2-(oxan-2-yl)ethyl]-4-pyridin-4-yl-1,2-oxazol-5-amine.
| Compound Name | 3-[2-(oxan-2-yl)ethyl]-4-pyridin-4-yl-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 80525003 |
| Molecular Formula | C15H19N3O2 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 3-[2-(oxan-2-yl)ethyl]-4-pyridin-4-yl-1,2-oxazol-5-amine |
| SMILES | Nc1onc(CCC2CCCCO2)c1-c1ccncc1 |
| InChI | InChI=1S/C15H19N3O2/c16-15-14(11-6-8-17-9-7-11)13(18-20-15)5-4-12-3-1-2-10-19-12/h6-9,12H,1-5,10,16H2 |
| InChIKey | LEMRIOXSXLUTDV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |