C4H8N3O2+ — CID 143383514
(5-amino-3-methyl-1,2-oxazol-4-yl)-hydroxyazanium (PubChem CID 143383514) has the molecular formula C4H8N3O2+ and a molecular weight of 130.13 g/mol. Its IUPAC name is (5-amino-3-methyl-1,2-oxazol-4-yl)-hydroxyazanium.
| Compound Name | (5-amino-3-methyl-1,2-oxazol-4-yl)-hydroxyazanium |
|---|---|
| PubChem CID | 143383514 |
| Molecular Formula | C4H8N3O2+ |
| Molecular Weight | 130.13 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | (5-amino-3-methyl-1,2-oxazol-4-yl)-hydroxyazanium |
| SMILES | Cc1noc(N)c1[NH2+]O |
| InChI | InChI=1S/C4H7N3O2/c1-2-3(6-8)4(5)9-7-2/h6,8H,5H2,1H3/p+1 |
| InChIKey | LPAHPGNBLXBVRV-UHFFFAOYSA-O |
| XLogP | -0.85 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.13 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|