About tert-butyl N-(5-amino-3-methyl-1,2-oxazol-4-yl)carbamate
tert-butyl N-(5-amino-3-methyl-1,2-oxazol-4-yl)carbamate (PubChem CID 117274287) has the molecular formula C9H15N3O3
and a molecular weight of 213.24 g/mol. Its IUPAC name is tert-butyl N-(5-amino-3-methyl-1,2-oxazol-4-yl)carbamate.
Analyze tert-butyl N-(5-amino-3-methyl-1,2-oxazol-4-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(5-amino-3-methyl-1,2-oxazol-4-yl)carbamate?
The IUPAC name of tert-butyl N-(5-amino-3-methyl-1,2-oxazol-4-yl)carbamate (CID 117274287) is tert-butyl N-(5-amino-3-methyl-1,2-oxazol-4-yl)carbamate.
What is the SMILES notation for tert-butyl N-(5-amino-3-methyl-1,2-oxazol-4-yl)carbamate?
The canonical SMILES for tert-butyl N-(5-amino-3-methyl-1,2-oxazol-4-yl)carbamate is Cc1noc(N)c1NC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-(5-amino-3-methyl-1,2-oxazol-4-yl)carbamate?
The InChIKey is GNPIWYZXZNXMPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O3/c1-5-6(7(10)15-12-5)11-8(13)14-9(2,3)4/h10H2,1-4H3,(H,11,13).
What are the key properties of tert-butyl N-(5-amino-3-methyl-1,2-oxazol-4-yl)carbamate?
tert-butyl N-(5-amino-3-methyl-1,2-oxazol-4-yl)carbamate has a molecular weight of 213.24 g/mol, XLogP of 1.91, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(5-amino-3-methyl-1,2-oxazol-4-yl)carbamate is sourced from PubChem (CID 117274287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).