C11H19N3O3 — CID 107236775
tert-butyl N-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]carbamate (PubChem CID 107236775) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is tert-butyl N-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]carbamate.
| Compound Name | tert-butyl N-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]carbamate |
|---|---|
| PubChem CID | 107236775 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | tert-butyl N-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]carbamate |
| SMILES | Cc1noc(C)c1CNNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H19N3O3/c1-7-9(8(2)17-14-7)6-12-13-10(15)16-11(3,4)5/h12H,6H2,1-5H3,(H,13,15) |
| InChIKey | YIKVRMUNQQKLGB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|