C12H22N4O2 — CID 107236747
tert-butyl N-[(1,3,5-trimethylpyrazol-4-yl)methylamino]carbamate (PubChem CID 107236747) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is tert-butyl N-[(1,3,5-trimethylpyrazol-4-yl)methylamino]carbamate.
| Compound Name | tert-butyl N-[(1,3,5-trimethylpyrazol-4-yl)methylamino]carbamate |
|---|---|
| PubChem CID | 107236747 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | tert-butyl N-[(1,3,5-trimethylpyrazol-4-yl)methylamino]carbamate |
| SMILES | Cc1nn(C)c(C)c1CNNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H22N4O2/c1-8-10(9(2)16(6)15-8)7-13-14-11(17)18-12(3,4)5/h13H,7H2,1-6H3,(H,14,17) |
| InChIKey | IDGFQFKLNFZQKK-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|