About methyl N-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamate
methyl N-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamate (PubChem CID 110731133) has the molecular formula C9H15N3O2
and a molecular weight of 197.24 g/mol. Its IUPAC name is methyl N-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamate.
Analyze methyl N-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamate?
The IUPAC name of methyl N-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamate (CID 110731133) is methyl N-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamate.
What is the SMILES notation for methyl N-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamate?
The canonical SMILES for methyl N-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamate is COC(=O)NCc1c(C)nn(C)c1C.
What is the InChIKey of methyl N-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamate?
The InChIKey is MXFVVALKPIBBFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O2/c1-6-8(5-10-9(13)14-4)7(2)12(3)11-6/h5H2,1-4H3,(H,10,13).
What are the key properties of methyl N-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamate?
methyl N-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamate has a molecular weight of 197.24 g/mol, XLogP of 0.89, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamate is sourced from PubChem (CID 110731133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).