C9H15N3OS — CID 79237772
2-sulfanyl-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]acetamide (PubChem CID 79237772) has the molecular formula C9H15N3OS and a molecular weight of 213.31 g/mol. Its IUPAC name is 2-sulfanyl-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]acetamide.
| Compound Name | 2-sulfanyl-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 79237772 |
| Molecular Formula | C9H15N3OS |
| Molecular Weight | 213.31 g/mol |
| Exact Mass | 213.09 |
| IUPAC Name | 2-sulfanyl-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]acetamide |
| SMILES | Cc1nn(C)c(C)c1CNC(=O)CS |
| InChI | InChI=1S/C9H15N3OS/c1-6-8(4-10-9(13)5-14)7(2)12(3)11-6/h14H,4-5H2,1-3H3,(H,10,13) |
| InChIKey | BFBURIGFNHBUJW-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|