C18H26N4O — CID 110441139
3-[4-(dimethylamino)phenyl]-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]propanamide (PubChem CID 110441139) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is 3-[4-(dimethylamino)phenyl]-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]propanamide.
| Compound Name | 3-[4-(dimethylamino)phenyl]-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]propanamide |
|---|---|
| PubChem CID | 110441139 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 3-[4-(dimethylamino)phenyl]-N-[(1,3,5-trimethylpyrazol-4-yl)methyl]propanamide |
| SMILES | Cc1nn(C)c(C)c1CNC(=O)CCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C18H26N4O/c1-13-17(14(2)22(5)20-13)12-19-18(23)11-8-15-6-9-16(10-7-15)21(3)4/h6-7,9-10H,8,11-12H2,1-5H3,(H,19,23) |
| InChIKey | RTGSDYQWWUBVQJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|