C12H12F4N2O3 — CID 58895114
tert-butyl N-(2-carbamoyl-3,4,5,6-tetrafluorophenyl)carbamate (PubChem CID 58895114) has the molecular formula C12H12F4N2O3 and a molecular weight of 308.23 g/mol. Its IUPAC name is tert-butyl N-(2-carbamoyl-3,4,5,6-tetrafluorophenyl)carbamate.
| Compound Name | tert-butyl N-(2-carbamoyl-3,4,5,6-tetrafluorophenyl)carbamate |
|---|---|
| PubChem CID | 58895114 |
| Molecular Formula | C12H12F4N2O3 |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | tert-butyl N-(2-carbamoyl-3,4,5,6-tetrafluorophenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1c(F)c(F)c(F)c(F)c1C(N)=O |
| InChI | InChI=1S/C12H12F4N2O3/c1-12(2,3)21-11(20)18-9-4(10(17)19)5(13)6(14)7(15)8(9)16/h1-3H3,(H2,17,19)(H,18,20) |
| InChIKey | TYQPDAFSVOANFU-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|