C15H20F3NO3Si — CID 168856657
tert-butyl N-(2,3,5-trifluoro-6-formyl-4-trimethylsilylphenyl)carbamate (PubChem CID 168856657) has the molecular formula C15H20F3NO3Si and a molecular weight of 347.41 g/mol. Its IUPAC name is tert-butyl N-(2,3,5-trifluoro-6-formyl-4-trimethylsilylphenyl)carbamate.
| Compound Name | tert-butyl N-(2,3,5-trifluoro-6-formyl-4-trimethylsilylphenyl)carbamate |
|---|---|
| PubChem CID | 168856657 |
| Molecular Formula | C15H20F3NO3Si |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | tert-butyl N-(2,3,5-trifluoro-6-formyl-4-trimethylsilylphenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1c(F)c(F)c([Si](C)(C)C)c(F)c1C=O |
| InChI | InChI=1S/C15H20F3NO3Si/c1-15(2,3)22-14(21)19-12-8(7-20)9(16)13(23(4,5)6)11(18)10(12)17/h7H,1-6H3,(H,19,21) |
| InChIKey | PGQMQVSFGUOBFC-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|