About 4-(1,1-dideuterioethyl)-3-methyl-1,2-oxazol-5-amine
4-(1,1-dideuterioethyl)-3-methyl-1,2-oxazol-5-amine (PubChem CID 13317380) has the molecular formula C6H10N2O
and a molecular weight of 128.17 g/mol. Its IUPAC name is 4-(1,1-dideuterioethyl)-3-methyl-1,2-oxazol-5-amine.
Analyze 4-(1,1-dideuterioethyl)-3-methyl-1,2-oxazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,1-dideuterioethyl)-3-methyl-1,2-oxazol-5-amine?
The IUPAC name of 4-(1,1-dideuterioethyl)-3-methyl-1,2-oxazol-5-amine (CID 13317380) is 4-(1,1-dideuterioethyl)-3-methyl-1,2-oxazol-5-amine.
What is the SMILES notation for 4-(1,1-dideuterioethyl)-3-methyl-1,2-oxazol-5-amine?
The canonical SMILES for 4-(1,1-dideuterioethyl)-3-methyl-1,2-oxazol-5-amine is [2H]C([2H])(C)c1c(C)noc1N.
What is the InChIKey of 4-(1,1-dideuterioethyl)-3-methyl-1,2-oxazol-5-amine?
The InChIKey is JBQKXIAKMNHYEI-SMZGMGDZSA-N. The full InChI is InChI=1S/C6H10N2O/c1-3-5-4(2)8-9-6(5)7/h3,7H2,1-2H3/i3D2.
What are the key properties of 4-(1,1-dideuterioethyl)-3-methyl-1,2-oxazol-5-amine?
4-(1,1-dideuterioethyl)-3-methyl-1,2-oxazol-5-amine has a molecular weight of 128.17 g/mol, XLogP of 1.13, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,1-dideuterioethyl)-3-methyl-1,2-oxazol-5-amine is sourced from PubChem (CID 13317380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).