C10H10N2O2 — CID 135818847
2-(4-amino-3-methyl-1,2-oxazol-5-yl)phenol (PubChem CID 135818847) has the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. Its IUPAC name is 2-(4-amino-3-methyl-1,2-oxazol-5-yl)phenol.
| Compound Name | 2-(4-amino-3-methyl-1,2-oxazol-5-yl)phenol |
|---|---|
| PubChem CID | 135818847 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 2-(4-amino-3-methyl-1,2-oxazol-5-yl)phenol |
| SMILES | Cc1noc(-c2ccccc2O)c1N |
| InChI | InChI=1S/C10H10N2O2/c1-6-9(11)10(14-12-6)7-4-2-3-5-8(7)13/h2-5,13H,11H2,1H3 |
| InChIKey | NDEUCUWMRLWNIB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |