C11H13N3O — CID 154305895
3-(3,5-dimethyl-1,2-oxazol-4-yl)benzene-1,2-diamine (PubChem CID 154305895) has the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. Its IUPAC name is 3-(3,5-dimethyl-1,2-oxazol-4-yl)benzene-1,2-diamine.
| Compound Name | 3-(3,5-dimethyl-1,2-oxazol-4-yl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 154305895 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 3-(3,5-dimethyl-1,2-oxazol-4-yl)benzene-1,2-diamine |
| SMILES | Cc1noc(C)c1-c1cccc(N)c1N |
| InChI | InChI=1S/C11H13N3O/c1-6-10(7(2)15-14-6)8-4-3-5-9(12)11(8)13/h3-5H,12-13H2,1-2H3 |
| InChIKey | GIOBFBUJRAFPBU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|