C16H14NO3+ — CID 155722733
[3-hydroxy-4-(3-methyl-4-phenyl-1,2-oxazol-5-yl)phenyl]oxidanium (PubChem CID 155722733) has the molecular formula C16H14NO3+ and a molecular weight of 268.29 g/mol. Its IUPAC name is [3-hydroxy-4-(3-methyl-4-phenyl-1,2-oxazol-5-yl)phenyl]oxidanium.
| Compound Name | [3-hydroxy-4-(3-methyl-4-phenyl-1,2-oxazol-5-yl)phenyl]oxidanium |
|---|---|
| PubChem CID | 155722733 |
| Molecular Formula | C16H14NO3+ |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | [3-hydroxy-4-(3-methyl-4-phenyl-1,2-oxazol-5-yl)phenyl]oxidanium |
| SMILES | Cc1noc(-c2ccc([OH2+])cc2O)c1-c1ccccc1 |
| InChI | InChI=1S/C16H13NO3/c1-10-15(11-5-3-2-4-6-11)16(20-17-10)13-8-7-12(18)9-14(13)19/h2-9,18-19H,1H3/p+1 |
| InChIKey | UZUXPZBCKKWSLB-UHFFFAOYSA-O |
| XLogP | 3.46 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|