C24H29N2O5P — CID 86591382
N-[4-(diethoxyphosphorylmethyl)phenyl]-3-(3-methyl-5-phenyl-1,2-oxazol-4-yl)propanamide (PubChem CID 86591382) has the molecular formula C24H29N2O5P and a molecular weight of 456.48 g/mol. Its IUPAC name is N-[4-(diethoxyphosphorylmethyl)phenyl]-3-(3-methyl-5-phenyl-1,2-oxazol-4-yl)propanamide.
| Compound Name | N-[4-(diethoxyphosphorylmethyl)phenyl]-3-(3-methyl-5-phenyl-1,2-oxazol-4-yl)propanamide |
|---|---|
| PubChem CID | 86591382 |
| Molecular Formula | C24H29N2O5P |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-[4-(diethoxyphosphorylmethyl)phenyl]-3-(3-methyl-5-phenyl-1,2-oxazol-4-yl)propanamide |
| SMILES | CCOP(=O)(Cc1ccc(NC(=O)CCc2c(C)noc2-c2ccccc2)cc1)OCC |
| InChI | InChI=1S/C24H29N2O5P/c1-4-29-32(28,30-5-2)17-19-11-13-21(14-12-19)25-23(27)16-15-22-18(3)26-31-24(22)20-9-7-6-8-10-20/h6-14H,4-5,15-17H2,1-3H3,(H,25,27) |
| InChIKey | NAECSZZIQIOTQG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|