C22H25N2O5P — CID 87889786
N-[4-(dimethoxyphosphorylmethyl)phenyl]-4-(5-phenyl-1,2-oxazol-4-yl)butanamide (PubChem CID 87889786) has the molecular formula C22H25N2O5P and a molecular weight of 428.43 g/mol. Its IUPAC name is N-[4-(dimethoxyphosphorylmethyl)phenyl]-4-(5-phenyl-1,2-oxazol-4-yl)butanamide.
| Compound Name | N-[4-(dimethoxyphosphorylmethyl)phenyl]-4-(5-phenyl-1,2-oxazol-4-yl)butanamide |
|---|---|
| PubChem CID | 87889786 |
| Molecular Formula | C22H25N2O5P |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | N-[4-(dimethoxyphosphorylmethyl)phenyl]-4-(5-phenyl-1,2-oxazol-4-yl)butanamide |
| SMILES | COP(=O)(Cc1ccc(NC(=O)CCCc2cnoc2-c2ccccc2)cc1)OC |
| InChI | InChI=1S/C22H25N2O5P/c1-27-30(26,28-2)16-17-11-13-20(14-12-17)24-21(25)10-6-9-19-15-23-29-22(19)18-7-4-3-5-8-18/h3-5,7-8,11-15H,6,9-10,16H2,1-2H3,(H,24,25) |
| InChIKey | BCZUYNVAWQDOAY-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|