C24H28FN2O5P — CID 22221166
N-[4-(2-diethoxyphosphorylethyl)phenyl]-3-[5-(4-fluorophenyl)-1,2-oxazol-4-yl]propanamide (PubChem CID 22221166) has the molecular formula C24H28FN2O5P and a molecular weight of 474.47 g/mol. Its IUPAC name is N-[4-(2-diethoxyphosphorylethyl)phenyl]-3-[5-(4-fluorophenyl)-1,2-oxazol-4-yl]propanamide.
| Compound Name | N-[4-(2-diethoxyphosphorylethyl)phenyl]-3-[5-(4-fluorophenyl)-1,2-oxazol-4-yl]propanamide |
|---|---|
| PubChem CID | 22221166 |
| Molecular Formula | C24H28FN2O5P |
| Molecular Weight | 474.47 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | N-[4-(2-diethoxyphosphorylethyl)phenyl]-3-[5-(4-fluorophenyl)-1,2-oxazol-4-yl]propanamide |
| SMILES | CCOP(=O)(CCc1ccc(NC(=O)CCc2cnoc2-c2ccc(F)cc2)cc1)OCC |
| InChI | InChI=1S/C24H28FN2O5P/c1-3-30-33(29,31-4-2)16-15-18-5-12-22(13-6-18)27-23(28)14-9-20-17-26-32-24(20)19-7-10-21(25)11-8-19/h5-8,10-13,17H,3-4,9,14-16H2,1-2H3,(H,27,28) |
| InChIKey | LSQPOKZJTKIPML-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.47 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|