C23H25F2N2O5P — CID 87889597
N-[4-(diethoxyphosphorylmethyl)phenyl]-3-[5-(2,4-difluorophenyl)-1,2-oxazol-4-yl]propanamide (PubChem CID 87889597) has the molecular formula C23H25F2N2O5P and a molecular weight of 478.43 g/mol. Its IUPAC name is N-[4-(diethoxyphosphorylmethyl)phenyl]-3-[5-(2,4-difluorophenyl)-1,2-oxazol-4-yl]propanamide.
| Compound Name | N-[4-(diethoxyphosphorylmethyl)phenyl]-3-[5-(2,4-difluorophenyl)-1,2-oxazol-4-yl]propanamide |
|---|---|
| PubChem CID | 87889597 |
| Molecular Formula | C23H25F2N2O5P |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | N-[4-(diethoxyphosphorylmethyl)phenyl]-3-[5-(2,4-difluorophenyl)-1,2-oxazol-4-yl]propanamide |
| SMILES | CCOP(=O)(Cc1ccc(NC(=O)CCc2cnoc2-c2ccc(F)cc2F)cc1)OCC |
| InChI | InChI=1S/C23H25F2N2O5P/c1-3-30-33(29,31-4-2)15-16-5-9-19(10-6-16)27-22(28)12-7-17-14-26-32-23(17)20-11-8-18(24)13-21(20)25/h5-6,8-11,13-14H,3-4,7,12,15H2,1-2H3,(H,27,28) |
| InChIKey | UBVHDBPTKXDLKI-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|