C24H29N2O5P — CID 22221010
N-[4-(diethoxyphosphorylmethyl)phenyl]-4-(5-phenyl-1,2-oxazol-4-yl)butanamide (PubChem CID 22221010) has the molecular formula C24H29N2O5P and a molecular weight of 456.48 g/mol. Its IUPAC name is N-[4-(diethoxyphosphorylmethyl)phenyl]-4-(5-phenyl-1,2-oxazol-4-yl)butanamide.
| Compound Name | N-[4-(diethoxyphosphorylmethyl)phenyl]-4-(5-phenyl-1,2-oxazol-4-yl)butanamide |
|---|---|
| PubChem CID | 22221010 |
| Molecular Formula | C24H29N2O5P |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | N-[4-(diethoxyphosphorylmethyl)phenyl]-4-(5-phenyl-1,2-oxazol-4-yl)butanamide |
| SMILES | CCOP(=O)(Cc1ccc(NC(=O)CCCc2cnoc2-c2ccccc2)cc1)OCC |
| InChI | InChI=1S/C24H29N2O5P/c1-3-29-32(28,30-4-2)18-19-13-15-22(16-14-19)26-23(27)12-8-11-21-17-25-31-24(21)20-9-6-5-7-10-20/h5-7,9-10,13-17H,3-4,8,11-12,18H2,1-2H3,(H,26,27) |
| InChIKey | CSAFYVUULGWNKS-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|