4-(5-phenyl-1,2-oxazol-4-yl)butanoic acid

C13H13NO3 — CID 22221097

IUPAC4-(5-phenyl-1,2-oxazol-4-yl)butanoic acid
SMILESO=C(O)CCCc1cnoc1-c1ccccc1
InChIInChI=1S/C13H13NO3/c15-12(16)8-4-7-11-9-14-17-13(11)10-5-2-1-3-6-10/h1-3,5-6,9H,4,7-8H2,(H,15,16)
InChIKeyXEIKDSYQTSIHAH-UHFFFAOYSA-N
MW231.25 g/mol
LogP2.75
Rot. Bonds5

About 4-(5-phenyl-1,2-oxazol-4-yl)butanoic acid

4-(5-phenyl-1,2-oxazol-4-yl)butanoic acid (PubChem CID 22221097) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 4-(5-phenyl-1,2-oxazol-4-yl)butanoic acid.

Molecular Properties

Compound Name4-(5-phenyl-1,2-oxazol-4-yl)butanoic acid
PubChem CID22221097
Molecular FormulaC13H13NO3
Molecular Weight231.25 g/mol
Exact Mass231.09
IUPAC Name4-(5-phenyl-1,2-oxazol-4-yl)butanoic acid
SMILESO=C(O)CCCc1cnoc1-c1ccccc1
InChIInChI=1S/C13H13NO3/c15-12(16)8-4-7-11-9-14-17-13(11)10-5-2-1-3-6-10/h1-3,5-6,9H,4,7-8H2,(H,15,16)
InChIKeyXEIKDSYQTSIHAH-UHFFFAOYSA-N
XLogP2.75
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.25
LogP ≤ 52.75
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-(5-phenyl-1,2-oxazol-4-yl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(5-phenyl-1,2-oxazol-4-yl)butanoic acid?
The IUPAC name of 4-(5-phenyl-1,2-oxazol-4-yl)butanoic acid (CID 22221097) is 4-(5-phenyl-1,2-oxazol-4-yl)butanoic acid.
What is the SMILES notation for 4-(5-phenyl-1,2-oxazol-4-yl)butanoic acid?
The canonical SMILES for 4-(5-phenyl-1,2-oxazol-4-yl)butanoic acid is O=C(O)CCCc1cnoc1-c1ccccc1.
What is the InChIKey of 4-(5-phenyl-1,2-oxazol-4-yl)butanoic acid?
The InChIKey is XEIKDSYQTSIHAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO3/c15-12(16)8-4-7-11-9-14-17-13(11)10-5-2-1-3-6-10/h1-3,5-6,9H,4,7-8H2,(H,15,16).
What are the key properties of 4-(5-phenyl-1,2-oxazol-4-yl)butanoic acid?
4-(5-phenyl-1,2-oxazol-4-yl)butanoic acid has a molecular weight of 231.25 g/mol, XLogP of 2.75, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-phenyl-1,2-oxazol-4-yl)butanoic acid is sourced from PubChem (CID 22221097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).