C13H13NO3 — CID 54134483
4-hydroxy-1-(5-phenyl-1,2-oxazol-4-yl)butan-1-one (PubChem CID 54134483) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 4-hydroxy-1-(5-phenyl-1,2-oxazol-4-yl)butan-1-one.
| Compound Name | 4-hydroxy-1-(5-phenyl-1,2-oxazol-4-yl)butan-1-one |
|---|---|
| PubChem CID | 54134483 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 4-hydroxy-1-(5-phenyl-1,2-oxazol-4-yl)butan-1-one |
| SMILES | O=C(CCCO)c1cnoc1-c1ccccc1 |
| InChI | InChI=1S/C13H13NO3/c15-8-4-7-12(16)11-9-14-17-13(11)10-5-2-1-3-6-10/h1-3,5-6,9,15H,4,7-8H2 |
| InChIKey | NWRZPSTWHIAQHM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |