5-[3-(aminomethyl)phenyl]-1,2-oxazole-4-carboxylic acid

C11H10N2O3 — CID 150308140

IUPAC5-[3-(aminomethyl)phenyl]-1,2-oxazole-4-carboxylic acid
SMILESNCc1cccc(-c2oncc2C(=O)O)c1
InChIInChI=1S/C11H10N2O3/c12-5-7-2-1-3-8(4-7)10-9(11(14)15)6-13-16-10/h1-4,6H,5,12H2,(H,14,15)
InChIKeyGLAUEXRHECMZCC-UHFFFAOYSA-N
MW218.21 g/mol
LogP1.50
Rot. Bonds3

About 5-[3-(aminomethyl)phenyl]-1,2-oxazole-4-carboxylic acid

5-[3-(aminomethyl)phenyl]-1,2-oxazole-4-carboxylic acid (PubChem CID 150308140) has the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. Its IUPAC name is 5-[3-(aminomethyl)phenyl]-1,2-oxazole-4-carboxylic acid.

Molecular Properties

Compound Name5-[3-(aminomethyl)phenyl]-1,2-oxazole-4-carboxylic acid
PubChem CID150308140
Molecular FormulaC11H10N2O3
Molecular Weight218.21 g/mol
Exact Mass218.07
IUPAC Name5-[3-(aminomethyl)phenyl]-1,2-oxazole-4-carboxylic acid
SMILESNCc1cccc(-c2oncc2C(=O)O)c1
InChIInChI=1S/C11H10N2O3/c12-5-7-2-1-3-8(4-7)10-9(11(14)15)6-13-16-10/h1-4,6H,5,12H2,(H,14,15)
InChIKeyGLAUEXRHECMZCC-UHFFFAOYSA-N
XLogP1.50
TPSA89.35 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500218.21
LogP ≤ 51.50
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-[3-(aminomethyl)phenyl]-1,2-oxazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[3-(aminomethyl)phenyl]-1,2-oxazole-4-carboxylic acid?
The IUPAC name of 5-[3-(aminomethyl)phenyl]-1,2-oxazole-4-carboxylic acid (CID 150308140) is 5-[3-(aminomethyl)phenyl]-1,2-oxazole-4-carboxylic acid.
What is the SMILES notation for 5-[3-(aminomethyl)phenyl]-1,2-oxazole-4-carboxylic acid?
The canonical SMILES for 5-[3-(aminomethyl)phenyl]-1,2-oxazole-4-carboxylic acid is NCc1cccc(-c2oncc2C(=O)O)c1.
What is the InChIKey of 5-[3-(aminomethyl)phenyl]-1,2-oxazole-4-carboxylic acid?
The InChIKey is GLAUEXRHECMZCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O3/c12-5-7-2-1-3-8(4-7)10-9(11(14)15)6-13-16-10/h1-4,6H,5,12H2,(H,14,15).
What are the key properties of 5-[3-(aminomethyl)phenyl]-1,2-oxazole-4-carboxylic acid?
5-[3-(aminomethyl)phenyl]-1,2-oxazole-4-carboxylic acid has a molecular weight of 218.21 g/mol, XLogP of 1.50, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[3-(aminomethyl)phenyl]-1,2-oxazole-4-carboxylic acid is sourced from PubChem (CID 150308140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).