C22H23N2O5P — CID 87892510
N-[4-[(2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl]phenyl]-3-(5-phenyl-1,2-oxazol-4-yl)propanamide (PubChem CID 87892510) has the molecular formula C22H23N2O5P and a molecular weight of 426.41 g/mol. Its IUPAC name is N-[4-[(2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl]phenyl]-3-(5-phenyl-1,2-oxazol-4-yl)propanamide.
| Compound Name | N-[4-[(2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl]phenyl]-3-(5-phenyl-1,2-oxazol-4-yl)propanamide |
|---|---|
| PubChem CID | 87892510 |
| Molecular Formula | C22H23N2O5P |
| Molecular Weight | 426.41 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | N-[4-[(2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)methyl]phenyl]-3-(5-phenyl-1,2-oxazol-4-yl)propanamide |
| SMILES | O=C(CCc1cnoc1-c1ccccc1)Nc1ccc(CP2(=O)OCCCO2)cc1 |
| InChI | InChI=1S/C22H23N2O5P/c25-21(12-9-19-15-23-29-22(19)18-5-2-1-3-6-18)24-20-10-7-17(8-11-20)16-30(26)27-13-4-14-28-30/h1-3,5-8,10-11,15H,4,9,12-14,16H2,(H,24,25) |
| InChIKey | OUTZXLPGSHCSSI-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.41 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|