C24H26F3N2O6P — CID 87890103
N-[4-(diethoxyphosphorylmethyl)phenyl]-3-[5-[4-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]propanamide (PubChem CID 87890103) has the molecular formula C24H26F3N2O6P and a molecular weight of 526.45 g/mol. Its IUPAC name is N-[4-(diethoxyphosphorylmethyl)phenyl]-3-[5-[4-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]propanamide.
| Compound Name | N-[4-(diethoxyphosphorylmethyl)phenyl]-3-[5-[4-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]propanamide |
|---|---|
| PubChem CID | 87890103 |
| Molecular Formula | C24H26F3N2O6P |
| Molecular Weight | 526.45 g/mol |
| Exact Mass | 526.15 |
| IUPAC Name | N-[4-(diethoxyphosphorylmethyl)phenyl]-3-[5-[4-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]propanamide |
| SMILES | CCOP(=O)(Cc1ccc(NC(=O)CCc2cnoc2-c2ccc(OC(F)(F)F)cc2)cc1)OCC |
| InChI | InChI=1S/C24H26F3N2O6P/c1-3-32-36(31,33-4-2)16-17-5-10-20(11-6-17)29-22(30)14-9-19-15-28-35-23(19)18-7-12-21(13-8-18)34-24(25,26)27/h5-8,10-13,15H,3-4,9,14,16H2,1-2H3,(H,29,30) |
| InChIKey | LJGKNZVXSSCVPK-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 99.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.45 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|