C24H29N2O7PS — CID 87890022
N-[4-(diethoxyphosphorylmethyl)phenyl]-3-[5-(4-methylsulfonylphenyl)-1,2-oxazol-4-yl]propanamide (PubChem CID 87890022) has the molecular formula C24H29N2O7PS and a molecular weight of 520.54 g/mol. Its IUPAC name is N-[4-(diethoxyphosphorylmethyl)phenyl]-3-[5-(4-methylsulfonylphenyl)-1,2-oxazol-4-yl]propanamide.
| Compound Name | N-[4-(diethoxyphosphorylmethyl)phenyl]-3-[5-(4-methylsulfonylphenyl)-1,2-oxazol-4-yl]propanamide |
|---|---|
| PubChem CID | 87890022 |
| Molecular Formula | C24H29N2O7PS |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | N-[4-(diethoxyphosphorylmethyl)phenyl]-3-[5-(4-methylsulfonylphenyl)-1,2-oxazol-4-yl]propanamide |
| SMILES | CCOP(=O)(Cc1ccc(NC(=O)CCc2cnoc2-c2ccc(S(C)(=O)=O)cc2)cc1)OCC |
| InChI | InChI=1S/C24H29N2O7PS/c1-4-31-34(28,32-5-2)17-18-6-11-21(12-7-18)26-23(27)15-10-20-16-25-33-24(20)19-8-13-22(14-9-19)35(3,29)30/h6-9,11-14,16H,4-5,10,15,17H2,1-3H3,(H,26,27) |
| InChIKey | ZLJGFIXDCYVOAA-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|