C30H33ClN3O5P — CID 87796915
3-[2-(benzylamino)-4-(4-chlorophenyl)-1,3-oxazol-5-yl]-N-[4-(diethoxyphosphorylmethyl)phenyl]propanamide (PubChem CID 87796915) has the molecular formula C30H33ClN3O5P and a molecular weight of 582.04 g/mol. Its IUPAC name is 3-[2-(benzylamino)-4-(4-chlorophenyl)-1,3-oxazol-5-yl]-N-[4-(diethoxyphosphorylmethyl)phenyl]propanamide.
| Compound Name | 3-[2-(benzylamino)-4-(4-chlorophenyl)-1,3-oxazol-5-yl]-N-[4-(diethoxyphosphorylmethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 87796915 |
| Molecular Formula | C30H33ClN3O5P |
| Molecular Weight | 582.04 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | 3-[2-(benzylamino)-4-(4-chlorophenyl)-1,3-oxazol-5-yl]-N-[4-(diethoxyphosphorylmethyl)phenyl]propanamide |
| SMILES | CCOP(=O)(Cc1ccc(NC(=O)CCc2oc(NCc3ccccc3)nc2-c2ccc(Cl)cc2)cc1)OCC |
| InChI | InChI=1S/C30H33ClN3O5P/c1-3-37-40(36,38-4-2)21-23-10-16-26(17-11-23)33-28(35)19-18-27-29(24-12-14-25(31)15-13-24)34-30(39-27)32-20-22-8-6-5-7-9-22/h5-17H,3-4,18-21H2,1-2H3,(H,32,34)(H,33,35) |
| InChIKey | IMBZEBZFVGRXSW-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.04 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|