C21H22ClN2O5P — CID 139968628
3-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-[4-(dimethoxyphosphorylmethyl)phenyl]propanamide (PubChem CID 139968628) has the molecular formula C21H22ClN2O5P and a molecular weight of 448.84 g/mol. Its IUPAC name is 3-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-[4-(dimethoxyphosphorylmethyl)phenyl]propanamide.
| Compound Name | 3-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-[4-(dimethoxyphosphorylmethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 139968628 |
| Molecular Formula | C21H22ClN2O5P |
| Molecular Weight | 448.84 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 3-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-[4-(dimethoxyphosphorylmethyl)phenyl]propanamide |
| SMILES | COP(=O)(Cc1ccc(NC(=O)CCc2cc(-c3ccc(Cl)cc3)on2)cc1)OC |
| InChI | InChI=1S/C21H22ClN2O5P/c1-27-30(26,28-2)14-15-3-9-18(10-4-15)23-21(25)12-11-19-13-20(29-24-19)16-5-7-17(22)8-6-16/h3-10,13H,11-12,14H2,1-2H3,(H,23,25) |
| InChIKey | UCEGWRDHKGKSOZ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.84 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|