C12H11ClN2O3 — CID 110619836
2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-methoxyacetamide (PubChem CID 110619836) has the molecular formula C12H11ClN2O3 and a molecular weight of 266.68 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-methoxyacetamide.
| Compound Name | 2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-methoxyacetamide |
|---|---|
| PubChem CID | 110619836 |
| Molecular Formula | C12H11ClN2O3 |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-methoxyacetamide |
| SMILES | CONC(=O)Cc1cc(-c2ccc(Cl)cc2)on1 |
| InChI | InChI=1S/C12H11ClN2O3/c1-17-15-12(16)7-10-6-11(18-14-10)8-2-4-9(13)5-3-8/h2-6H,7H2,1H3,(H,15,16) |
| InChIKey | RBBKRYFGUCQFDW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|