C23H17ClN2O2 — CID 16878671
2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-(2-phenylphenyl)acetamide (PubChem CID 16878671) has the molecular formula C23H17ClN2O2 and a molecular weight of 388.85 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-(2-phenylphenyl)acetamide.
| Compound Name | 2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-(2-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 16878671 |
| Molecular Formula | C23H17ClN2O2 |
| Molecular Weight | 388.85 g/mol |
| Exact Mass | 388.10 |
| IUPAC Name | 2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-(2-phenylphenyl)acetamide |
| SMILES | O=C(Cc1cc(-c2ccc(Cl)cc2)on1)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C23H17ClN2O2/c24-18-12-10-17(11-13-18)22-14-19(26-28-22)15-23(27)25-21-9-5-4-8-20(21)16-6-2-1-3-7-16/h1-14H,15H2,(H,25,27) |
| InChIKey | CXZBXFNPRFOQOP-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.85 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |