C19H26ClN3O3 — CID 110619907
2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-[2-[2-(diethylamino)ethoxy]ethyl]acetamide (PubChem CID 110619907) has the molecular formula C19H26ClN3O3 and a molecular weight of 379.89 g/mol. Its IUPAC name is 2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-[2-[2-(diethylamino)ethoxy]ethyl]acetamide.
| Compound Name | 2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-[2-[2-(diethylamino)ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 110619907 |
| Molecular Formula | C19H26ClN3O3 |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.17 |
| IUPAC Name | 2-[5-(4-chlorophenyl)-1,2-oxazol-3-yl]-N-[2-[2-(diethylamino)ethoxy]ethyl]acetamide |
| SMILES | CCN(CC)CCOCCNC(=O)Cc1cc(-c2ccc(Cl)cc2)on1 |
| InChI | InChI=1S/C19H26ClN3O3/c1-3-23(4-2)10-12-25-11-9-21-19(24)14-17-13-18(26-22-17)15-5-7-16(20)8-6-15/h5-8,13H,3-4,9-12,14H2,1-2H3,(H,21,24) |
| InChIKey | DXHMZRIVJIXTSU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|