C19H17ClN3O4PS-2 — CID 21088706
3-[2-amino-4-(4-chlorophenyl)-1,3-thiazol-5-yl]-N-[4-(phosphonatomethyl)phenyl]propanamide (PubChem CID 21088706) has the molecular formula C19H17ClN3O4PS-2 and a molecular weight of 449.86 g/mol. Its IUPAC name is 3-[2-amino-4-(4-chlorophenyl)-1,3-thiazol-5-yl]-N-[4-(phosphonatomethyl)phenyl]propanamide.
| Compound Name | 3-[2-amino-4-(4-chlorophenyl)-1,3-thiazol-5-yl]-N-[4-(phosphonatomethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 21088706 |
| Molecular Formula | C19H17ClN3O4PS-2 |
| Molecular Weight | 449.86 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | 3-[2-amino-4-(4-chlorophenyl)-1,3-thiazol-5-yl]-N-[4-(phosphonatomethyl)phenyl]propanamide |
| SMILES | Nc1nc(-c2ccc(Cl)cc2)c(CCC(=O)Nc2ccc(CP(=O)([O-])[O-])cc2)s1 |
| InChI | InChI=1S/C19H19ClN3O4PS/c20-14-5-3-13(4-6-14)18-16(29-19(21)23-18)9-10-17(24)22-15-7-1-12(2-8-15)11-28(25,26)27/h1-8H,9-11H2,(H2,21,23)(H,22,24)(H2,25,26,27)/p-2 |
| InChIKey | CFZHROCCOXXPBX-UHFFFAOYSA-L |
| XLogP | 3.03 |
| TPSA | 131.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.86 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|