C19H16Cl2N2O3S2 — CID 164624383
3-[2,4-bis(4-chlorophenyl)-1,3-thiazol-5-yl]-N-methylsulfonylpropanamide (PubChem CID 164624383) has the molecular formula C19H16Cl2N2O3S2 and a molecular weight of 455.39 g/mol. Its IUPAC name is 3-[2,4-bis(4-chlorophenyl)-1,3-thiazol-5-yl]-N-methylsulfonylpropanamide.
| Compound Name | 3-[2,4-bis(4-chlorophenyl)-1,3-thiazol-5-yl]-N-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 164624383 |
| Molecular Formula | C19H16Cl2N2O3S2 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 454.00 |
| IUPAC Name | 3-[2,4-bis(4-chlorophenyl)-1,3-thiazol-5-yl]-N-methylsulfonylpropanamide |
| SMILES | CS(=O)(=O)NC(=O)CCc1sc(-c2ccc(Cl)cc2)nc1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H16Cl2N2O3S2/c1-28(25,26)23-17(24)11-10-16-18(12-2-6-14(20)7-3-12)22-19(27-16)13-4-8-15(21)9-5-13/h2-9H,10-11H2,1H3,(H,23,24) |
| InChIKey | DCEVVAOAHWORPZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |