C26H28ClN4O5P — CID 86760440
3-[4-(4-chlorophenyl)-2-imidazol-1-yl-1,3-oxazol-5-yl]-N-[4-(diethoxyphosphorylmethyl)phenyl]propanamide (PubChem CID 86760440) has the molecular formula C26H28ClN4O5P and a molecular weight of 542.96 g/mol. Its IUPAC name is 3-[4-(4-chlorophenyl)-2-imidazol-1-yl-1,3-oxazol-5-yl]-N-[4-(diethoxyphosphorylmethyl)phenyl]propanamide.
| Compound Name | 3-[4-(4-chlorophenyl)-2-imidazol-1-yl-1,3-oxazol-5-yl]-N-[4-(diethoxyphosphorylmethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 86760440 |
| Molecular Formula | C26H28ClN4O5P |
| Molecular Weight | 542.96 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | 3-[4-(4-chlorophenyl)-2-imidazol-1-yl-1,3-oxazol-5-yl]-N-[4-(diethoxyphosphorylmethyl)phenyl]propanamide |
| SMILES | CCOP(=O)(Cc1ccc(NC(=O)CCc2oc(-n3ccnc3)nc2-c2ccc(Cl)cc2)cc1)OCC |
| InChI | InChI=1S/C26H28ClN4O5P/c1-3-34-37(33,35-4-2)17-19-5-11-22(12-6-19)29-24(32)14-13-23-25(20-7-9-21(27)10-8-20)30-26(36-23)31-16-15-28-18-31/h5-12,15-16,18H,3-4,13-14,17H2,1-2H3,(H,29,32) |
| InChIKey | FWQUVBUTEZBHEQ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.96 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|