C30H30ClN4O5P — CID 87796761
3-[2-(benzimidazol-1-yl)-4-(3-chlorophenyl)-1,3-oxazol-5-yl]-N-[4-(diethoxyphosphorylmethyl)phenyl]propanamide (PubChem CID 87796761) has the molecular formula C30H30ClN4O5P and a molecular weight of 593.02 g/mol. Its IUPAC name is 3-[2-(benzimidazol-1-yl)-4-(3-chlorophenyl)-1,3-oxazol-5-yl]-N-[4-(diethoxyphosphorylmethyl)phenyl]propanamide.
| Compound Name | 3-[2-(benzimidazol-1-yl)-4-(3-chlorophenyl)-1,3-oxazol-5-yl]-N-[4-(diethoxyphosphorylmethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 87796761 |
| Molecular Formula | C30H30ClN4O5P |
| Molecular Weight | 593.02 g/mol |
| Exact Mass | 592.16 |
| IUPAC Name | 3-[2-(benzimidazol-1-yl)-4-(3-chlorophenyl)-1,3-oxazol-5-yl]-N-[4-(diethoxyphosphorylmethyl)phenyl]propanamide |
| SMILES | CCOP(=O)(Cc1ccc(NC(=O)CCc2oc(-n3cnc4ccccc43)nc2-c2cccc(Cl)c2)cc1)OCC |
| InChI | InChI=1S/C30H30ClN4O5P/c1-3-38-41(37,39-4-2)19-21-12-14-24(15-13-21)33-28(36)17-16-27-29(22-8-7-9-23(31)18-22)34-30(40-27)35-20-32-25-10-5-6-11-26(25)35/h5-15,18,20H,3-4,16-17,19H2,1-2H3,(H,33,36) |
| InChIKey | FXRAXPVBAMZUKS-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 108.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.02 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|