C30H30ClN4O5P — CID 21088557
3-[4-[3-[2-(benzimidazol-1-yl)-4-(3-chlorophenyl)-1,3-oxazol-5-yl]propanoylamino]phenyl]pentan-3-ylphosphonic acid (PubChem CID 21088557) has the molecular formula C30H30ClN4O5P and a molecular weight of 593.02 g/mol. Its IUPAC name is 3-[4-[3-[2-(benzimidazol-1-yl)-4-(3-chlorophenyl)-1,3-oxazol-5-yl]propanoylamino]phenyl]pentan-3-ylphosphonic acid.
| Compound Name | 3-[4-[3-[2-(benzimidazol-1-yl)-4-(3-chlorophenyl)-1,3-oxazol-5-yl]propanoylamino]phenyl]pentan-3-ylphosphonic acid |
|---|---|
| PubChem CID | 21088557 |
| Molecular Formula | C30H30ClN4O5P |
| Molecular Weight | 593.02 g/mol |
| Exact Mass | 592.16 |
| IUPAC Name | 3-[4-[3-[2-(benzimidazol-1-yl)-4-(3-chlorophenyl)-1,3-oxazol-5-yl]propanoylamino]phenyl]pentan-3-ylphosphonic acid |
| SMILES | CCC(CC)(c1ccc(NC(=O)CCc2oc(-n3cnc4ccccc43)nc2-c2cccc(Cl)c2)cc1)P(=O)(O)O |
| InChI | InChI=1S/C30H30ClN4O5P/c1-3-30(4-2,41(37,38)39)21-12-14-23(15-13-21)33-27(36)17-16-26-28(20-8-7-9-22(31)18-20)34-29(40-26)35-19-32-24-10-5-6-11-25(24)35/h5-15,18-19H,3-4,16-17H2,1-2H3,(H,33,36)(H2,37,38,39) |
| InChIKey | PEQNAZIUZJKJIS-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 130.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.02 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|