C18H23N3O2 — CID 97307899
1-[(1S,2R)-2-methylcyclohexyl]-3-(3-methyl-5-phenyl-1,2-oxazol-4-yl)urea (PubChem CID 97307899) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 1-[(1S,2R)-2-methylcyclohexyl]-3-(3-methyl-5-phenyl-1,2-oxazol-4-yl)urea.
| Compound Name | 1-[(1S,2R)-2-methylcyclohexyl]-3-(3-methyl-5-phenyl-1,2-oxazol-4-yl)urea |
|---|---|
| PubChem CID | 97307899 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 1-[(1S,2R)-2-methylcyclohexyl]-3-(3-methyl-5-phenyl-1,2-oxazol-4-yl)urea |
| SMILES | Cc1noc(-c2ccccc2)c1NC(=O)N[C@H]1CCCC[C@H]1C |
| InChI | InChI=1S/C18H23N3O2/c1-12-8-6-7-11-15(12)19-18(22)20-16-13(2)21-23-17(16)14-9-4-3-5-10-14/h3-5,9-10,12,15H,6-8,11H2,1-2H3,(H2,19,20,22)/t12-,15+/m1/s1 |
| InChIKey | WCXUJDUXMGBZEZ-DOMZBBRYSA-N |
| XLogP | 4.35 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |