About 1-[(2,6-difluorophenyl)methyl]-3-[3-methyl-5-(4-phenylphenyl)-1,2-oxazol-4-yl]urea
1-[(2,6-difluorophenyl)methyl]-3-[3-methyl-5-(4-phenylphenyl)-1,2-oxazol-4-yl]urea (PubChem CID 141295972) has the molecular formula C24H19F2N3O2
and a molecular weight of 419.43 g/mol. Its IUPAC name is 1-[(2,6-difluorophenyl)methyl]-3-[3-methyl-5-(4-phenylphenyl)-1,2-oxazol-4-yl]urea.
Molecular Properties
| Compound Name | 1-[(2,6-difluorophenyl)methyl]-3-[3-methyl-5-(4-phenylphenyl)-1,2-oxazol-4-yl]urea |
| PubChem CID | 141295972 |
| Molecular Formula | C24H19F2N3O2 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 1-[(2,6-difluorophenyl)methyl]-3-[3-methyl-5-(4-phenylphenyl)-1,2-oxazol-4-yl]urea |
| SMILES | Cc1noc(-c2ccc(-c3ccccc3)cc2)c1NC(=O)NCc1c(F)cccc1F |
| InChI | InChI=1S/C24H19F2N3O2/c1-15-22(28-24(30)27-14-19-20(25)8-5-9-21(19)26)23(31-29-15)18-12-10-17(11-13-18)16-6-3-2-4-7-16/h2-13H,14H2,1H3,(H2,27,28,30) |
| InChIKey | ZATIURRFCHJHMU-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(2,6-difluorophenyl)methyl]-3-[3-methyl-5-(4-phenylphenyl)-1,2-oxazol-4-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,6-difluorophenyl)methyl]-3-[3-methyl-5-(4-phenylphenyl)-1,2-oxazol-4-yl]urea?
The IUPAC name of 1-[(2,6-difluorophenyl)methyl]-3-[3-methyl-5-(4-phenylphenyl)-1,2-oxazol-4-yl]urea (CID 141295972) is 1-[(2,6-difluorophenyl)methyl]-3-[3-methyl-5-(4-phenylphenyl)-1,2-oxazol-4-yl]urea.
What is the SMILES notation for 1-[(2,6-difluorophenyl)methyl]-3-[3-methyl-5-(4-phenylphenyl)-1,2-oxazol-4-yl]urea?
The canonical SMILES for 1-[(2,6-difluorophenyl)methyl]-3-[3-methyl-5-(4-phenylphenyl)-1,2-oxazol-4-yl]urea is Cc1noc(-c2ccc(-c3ccccc3)cc2)c1NC(=O)NCc1c(F)cccc1F.
What is the InChIKey of 1-[(2,6-difluorophenyl)methyl]-3-[3-methyl-5-(4-phenylphenyl)-1,2-oxazol-4-yl]urea?
The InChIKey is ZATIURRFCHJHMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H19F2N3O2/c1-15-22(28-24(30)27-14-19-20(25)8-5-9-21(19)26)23(31-29-15)18-12-10-17(11-13-18)16-6-3-2-4-7-16/h2-13H,14H2,1H3,(H2,27,28,30).
What are the key properties of 1-[(2,6-difluorophenyl)methyl]-3-[3-methyl-5-(4-phenylphenyl)-1,2-oxazol-4-yl]urea?
1-[(2,6-difluorophenyl)methyl]-3-[3-methyl-5-(4-phenylphenyl)-1,2-oxazol-4-yl]urea has a molecular weight of 419.43 g/mol, XLogP of 5.92, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,6-difluorophenyl)methyl]-3-[3-methyl-5-(4-phenylphenyl)-1,2-oxazol-4-yl]urea is sourced from PubChem (CID 141295972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).