C19H22O5 — CID 141345102
diethyl 3-(3-phenylpropyl)furan-2,5-dicarboxylate (PubChem CID 141345102) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is diethyl 3-(3-phenylpropyl)furan-2,5-dicarboxylate.
| Compound Name | diethyl 3-(3-phenylpropyl)furan-2,5-dicarboxylate |
|---|---|
| PubChem CID | 141345102 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | diethyl 3-(3-phenylpropyl)furan-2,5-dicarboxylate |
| SMILES | CCOC(=O)c1cc(CCCc2ccccc2)c(C(=O)OCC)o1 |
| InChI | InChI=1S/C19H22O5/c1-3-22-18(20)16-13-15(17(24-16)19(21)23-4-2)12-8-11-14-9-6-5-7-10-14/h5-7,9-10,13H,3-4,8,11-12H2,1-2H3 |
| InChIKey | YJUXPIZNDWFFDQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |