C5H7N3O3 — CID 12937514
ethyl 5-oxo-1,2-dihydrotriazole-4-carboxylate (PubChem CID 12937514) has the molecular formula C5H7N3O3 and a molecular weight of 157.13 g/mol. Its IUPAC name is ethyl 5-oxo-1,2-dihydrotriazole-4-carboxylate.
| Compound Name | ethyl 5-oxo-1,2-dihydrotriazole-4-carboxylate |
|---|---|
| PubChem CID | 12937514 |
| Molecular Formula | C5H7N3O3 |
| Molecular Weight | 157.13 g/mol |
| Exact Mass | 157.05 |
| IUPAC Name | ethyl 5-oxo-1,2-dihydrotriazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH][nH]c1=O |
| InChI | InChI=1S/C5H7N3O3/c1-2-11-5(10)3-4(9)7-8-6-3/h2H2,1H3,(H2,6,7,8,9) |
| InChIKey | XLXALEMGVGAONO-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 87.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.13 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |