C12H14N2O7 — CID 19935590
diethyl 6-methyl-5-nitro-2-oxo-1H-pyridine-3,4-dicarboxylate (PubChem CID 19935590) has the molecular formula C12H14N2O7 and a molecular weight of 298.25 g/mol. Its IUPAC name is diethyl 6-methyl-5-nitro-2-oxo-1H-pyridine-3,4-dicarboxylate.
| Compound Name | diethyl 6-methyl-5-nitro-2-oxo-1H-pyridine-3,4-dicarboxylate |
|---|---|
| PubChem CID | 19935590 |
| Molecular Formula | C12H14N2O7 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | diethyl 6-methyl-5-nitro-2-oxo-1H-pyridine-3,4-dicarboxylate |
| SMILES | CCOC(=O)c1c([N+](=O)[O-])c(C)[nH]c(=O)c1C(=O)OCC |
| InChI | InChI=1S/C12H14N2O7/c1-4-20-11(16)7-8(12(17)21-5-2)10(15)13-6(3)9(7)14(18)19/h4-5H2,1-3H3,(H,13,15) |
| InChIKey | RJSNJCJRPCCRSC-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 128.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|