C10H15ClN2O4S — CID 170658263
ethyl 2-chloro-5-(dimethylsulfamoyl)-1,2-dihydropyridine-3-carboxylate (PubChem CID 170658263) has the molecular formula C10H15ClN2O4S and a molecular weight of 294.76 g/mol. Its IUPAC name is ethyl 2-chloro-5-(dimethylsulfamoyl)-1,2-dihydropyridine-3-carboxylate.
| Compound Name | ethyl 2-chloro-5-(dimethylsulfamoyl)-1,2-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 170658263 |
| Molecular Formula | C10H15ClN2O4S |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | ethyl 2-chloro-5-(dimethylsulfamoyl)-1,2-dihydropyridine-3-carboxylate |
| SMILES | CCOC(=O)C1=CC(S(=O)(=O)N(C)C)=CNC1Cl |
| InChI | InChI=1S/C10H15ClN2O4S/c1-4-17-10(14)8-5-7(6-12-9(8)11)18(15,16)13(2)3/h5-6,9,12H,4H2,1-3H3 |
| InChIKey | HMBCRYWKLNJKQY-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|