C34H38N2O8 — CID 10698855
tetraethyl (6S,12R)-6,12-diphenyl-3,9-diazatricyclo[6.4.0.02,7]dodeca-4,10-diene-1,5,7,11-tetracarboxylate (PubChem CID 10698855) has the molecular formula C34H38N2O8 and a molecular weight of 602.68 g/mol. Its IUPAC name is tetraethyl (6S,12R)-6,12-diphenyl-3,9-diazatricyclo[6.4.0.02,7]dodeca-4,10-diene-1,5,7,11-tetracarboxylate.
| Compound Name | tetraethyl (6S,12R)-6,12-diphenyl-3,9-diazatricyclo[6.4.0.02,7]dodeca-4,10-diene-1,5,7,11-tetracarboxylate |
|---|---|
| PubChem CID | 10698855 |
| Molecular Formula | C34H38N2O8 |
| Molecular Weight | 602.68 g/mol |
| Exact Mass | 602.26 |
| IUPAC Name | tetraethyl (6S,12R)-6,12-diphenyl-3,9-diazatricyclo[6.4.0.02,7]dodeca-4,10-diene-1,5,7,11-tetracarboxylate |
| SMILES | CCOC(=O)C1=CNC2C(C(=O)OCC)(C3NC=C(C(=O)OCC)[C@H](c4ccccc4)C23C(=O)OCC)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C34H38N2O8/c1-5-41-27(37)23-19-35-29-33(31(39)43-7-3,25(23)21-15-11-9-12-16-21)30-34(29,32(40)44-8-4)26(22-17-13-10-14-18-22)24(20-36-30)28(38)42-6-2/h9-20,25-26,29-30,35-36H,5-8H2,1-4H3/t25-,26+,29?,30?,33?,34? |
| InChIKey | YXPTZYKJUZUFOD-GHWWVECRSA-N |
| XLogP | 3.50 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.68 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|