C22H30N2O8 — CID 101479592
tetraethyl 3,9-diazatricyclo[6.4.0.02,7]dodeca-4,10-diene-1,5,7,11-tetracarboxylate (PubChem CID 101479592) has the molecular formula C22H30N2O8 and a molecular weight of 450.49 g/mol. Its IUPAC name is tetraethyl 3,9-diazatricyclo[6.4.0.02,7]dodeca-4,10-diene-1,5,7,11-tetracarboxylate.
| Compound Name | tetraethyl 3,9-diazatricyclo[6.4.0.02,7]dodeca-4,10-diene-1,5,7,11-tetracarboxylate |
|---|---|
| PubChem CID | 101479592 |
| Molecular Formula | C22H30N2O8 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.20 |
| IUPAC Name | tetraethyl 3,9-diazatricyclo[6.4.0.02,7]dodeca-4,10-diene-1,5,7,11-tetracarboxylate |
| SMILES | CCOC(=O)C1=CNC2C(C(=O)OCC)(C1)C1NC=C(C(=O)OCC)CC21C(=O)OCC |
| InChI | InChI=1S/C22H30N2O8/c1-5-29-15(25)13-9-21(19(27)31-7-3)17(23-11-13)22(20(28)32-8-4)10-14(12-24-18(21)22)16(26)30-6-2/h11-12,17-18,23-24H,5-10H2,1-4H3 |
| InChIKey | VKHMCWWQFBJAOH-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|