C13H19NO4S — CID 86921528
ethyl 3-(dimethylsulfamoyl)-4,5-dimethylbenzoate (PubChem CID 86921528) has the molecular formula C13H19NO4S and a molecular weight of 285.37 g/mol. Its IUPAC name is ethyl 3-(dimethylsulfamoyl)-4,5-dimethylbenzoate.
| Compound Name | ethyl 3-(dimethylsulfamoyl)-4,5-dimethylbenzoate |
|---|---|
| PubChem CID | 86921528 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | ethyl 3-(dimethylsulfamoyl)-4,5-dimethylbenzoate |
| SMILES | CCOC(=O)c1cc(C)c(C)c(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C13H19NO4S/c1-6-18-13(15)11-7-9(2)10(3)12(8-11)19(16,17)14(4)5/h7-8H,6H2,1-5H3 |
| InChIKey | YPGPNLNEYHWBQD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |