C11H15NO5S — CID 43406432
3-[methoxy(methyl)sulfamoyl]-4,5-dimethylbenzoic acid (PubChem CID 43406432) has the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. Its IUPAC name is 3-[methoxy(methyl)sulfamoyl]-4,5-dimethylbenzoic acid.
| Compound Name | 3-[methoxy(methyl)sulfamoyl]-4,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 43406432 |
| Molecular Formula | C11H15NO5S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 3-[methoxy(methyl)sulfamoyl]-4,5-dimethylbenzoic acid |
| SMILES | CON(C)S(=O)(=O)c1cc(C(=O)O)cc(C)c1C |
| InChI | InChI=1S/C11H15NO5S/c1-7-5-9(11(13)14)6-10(8(7)2)18(15,16)12(3)17-4/h5-6H,1-4H3,(H,13,14) |
| InChIKey | YCAJSAWICMQSHX-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|