C10H17N3O4S — CID 82880935
ethyl 4-(dimethylsulfamoylamino)-2-methyl-1H-pyrrole-3-carboxylate (PubChem CID 82880935) has the molecular formula C10H17N3O4S and a molecular weight of 275.33 g/mol. Its IUPAC name is ethyl 4-(dimethylsulfamoylamino)-2-methyl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 4-(dimethylsulfamoylamino)-2-methyl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 82880935 |
| Molecular Formula | C10H17N3O4S |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | ethyl 4-(dimethylsulfamoylamino)-2-methyl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(NS(=O)(=O)N(C)C)c[nH]c1C |
| InChI | InChI=1S/C10H17N3O4S/c1-5-17-10(14)9-7(2)11-6-8(9)12-18(15,16)13(3)4/h6,11-12H,5H2,1-4H3 |
| InChIKey | HLFNPVDQVDYGSG-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |