C13H14N4O3 — CID 104669954
ethyl 2-methyl-4-(pyridazine-4-carbonylamino)-1H-pyrrole-3-carboxylate (PubChem CID 104669954) has the molecular formula C13H14N4O3 and a molecular weight of 274.28 g/mol. Its IUPAC name is ethyl 2-methyl-4-(pyridazine-4-carbonylamino)-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 2-methyl-4-(pyridazine-4-carbonylamino)-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 104669954 |
| Molecular Formula | C13H14N4O3 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | ethyl 2-methyl-4-(pyridazine-4-carbonylamino)-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccnnc2)c[nH]c1C |
| InChI | InChI=1S/C13H14N4O3/c1-3-20-13(19)11-8(2)14-7-10(11)17-12(18)9-4-5-15-16-6-9/h4-7,14H,3H2,1-2H3,(H,17,18) |
| InChIKey | QFISTMAYTDEQSN-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |