About ethyl pyridazine-4-carboxylate;hydron
ethyl pyridazine-4-carboxylate;hydron (PubChem CID 174586916) has the molecular formula C7H9N2O2+
and a molecular weight of 153.16 g/mol. Its IUPAC name is ethyl pyridazine-4-carboxylate;hydron.
Molecular Properties
| Compound Name | ethyl pyridazine-4-carboxylate;hydron |
| PubChem CID | 174586916 |
| Molecular Formula | C7H9N2O2+ |
| Molecular Weight | 153.16 g/mol |
| Exact Mass | 153.07 |
| IUPAC Name | ethyl pyridazine-4-carboxylate;hydron |
| SMILES | CCOC(=O)c1ccnnc1.[H+] |
| InChI | InChI=1S/C7H8N2O2/c1-2-11-7(10)6-3-4-8-9-5-6/h3-5H,2H2,1H3/p+1 |
| InChIKey | FVBGGKYTKXFLOV-UHFFFAOYSA-O |
| XLogP | 0.77 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.16 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl pyridazine-4-carboxylate;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl pyridazine-4-carboxylate;hydron?
The IUPAC name of ethyl pyridazine-4-carboxylate;hydron (CID 174586916) is ethyl pyridazine-4-carboxylate;hydron.
What is the SMILES notation for ethyl pyridazine-4-carboxylate;hydron?
The canonical SMILES for ethyl pyridazine-4-carboxylate;hydron is CCOC(=O)c1ccnnc1.[H+].
What is the InChIKey of ethyl pyridazine-4-carboxylate;hydron?
The InChIKey is FVBGGKYTKXFLOV-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H8N2O2/c1-2-11-7(10)6-3-4-8-9-5-6/h3-5H,2H2,1H3/p+1.
What are the key properties of ethyl pyridazine-4-carboxylate;hydron?
ethyl pyridazine-4-carboxylate;hydron has a molecular weight of 153.16 g/mol, XLogP of 0.77, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl pyridazine-4-carboxylate;hydron is sourced from PubChem (CID 174586916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).