C13H15N3O3 — CID 75391757
[2-[bis(prop-2-enyl)amino]-2-oxoethyl] pyridazine-4-carboxylate (PubChem CID 75391757) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is [2-[bis(prop-2-enyl)amino]-2-oxoethyl] pyridazine-4-carboxylate.
| Compound Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl] pyridazine-4-carboxylate |
|---|---|
| PubChem CID | 75391757 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl] pyridazine-4-carboxylate |
| SMILES | C=CCN(CC=C)C(=O)COC(=O)c1ccnnc1 |
| InChI | InChI=1S/C13H15N3O3/c1-3-7-16(8-4-2)12(17)10-19-13(18)11-5-6-14-15-9-11/h3-6,9H,1-2,7-8,10H2 |
| InChIKey | SVMZUXHRRZSYSU-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|